About carbamic acid;cobalt
carbamic acid;cobalt (PubChem CID 87314881) has the molecular formula CH3CoNO2
and a molecular weight of 119.97 g/mol. Its IUPAC name is carbamic acid;cobalt.
Molecular Properties
| Compound Name | carbamic acid;cobalt |
| PubChem CID | 87314881 |
| Molecular Formula | CH3CoNO2 |
| Molecular Weight | 119.97 g/mol |
| Exact Mass | 119.95 |
| IUPAC Name | carbamic acid;cobalt |
| SMILES | NC(=O)O.[Co] |
| InChI | InChI=1S/CH3NO2.Co/c2-1(3)4;/h2H2,(H,3,4); |
| InChIKey | QWXVGWIBAJVUSJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.97 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbamic acid;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;cobalt?
The IUPAC name of carbamic acid;cobalt (CID 87314881) is carbamic acid;cobalt.
What is the SMILES notation for carbamic acid;cobalt?
The canonical SMILES for carbamic acid;cobalt is NC(=O)O.[Co].
What is the InChIKey of carbamic acid;cobalt?
The InChIKey is QWXVGWIBAJVUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO2.Co/c2-1(3)4;/h2H2,(H,3,4);.
What are the key properties of carbamic acid;cobalt?
carbamic acid;cobalt has a molecular weight of 119.97 g/mol, XLogP of -0.38, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;cobalt is sourced from PubChem (CID 87314881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).