carbamic acid fluoride

CH3FNO2- — CID 169488270

IUPACcarbamic acid fluoride
SMILESNC(=O)O.[F-]
InChIInChI=1S/CH3NO2.FH/c2-1(3)4;/h2H2,(H,3,4);1H/p-1
InChIKeyIZARXXAOJOIUMH-UHFFFAOYSA-M
MW80.04 g/mol
LogP-3.37
Rot. Bonds

About carbamic acid fluoride

carbamic acid fluoride (PubChem CID 169488270) has the molecular formula CH3FNO2- and a molecular weight of 80.04 g/mol. Its IUPAC name is carbamic acid fluoride.

Molecular Properties

Compound Namecarbamic acid fluoride
PubChem CID169488270
Molecular FormulaCH3FNO2-
Molecular Weight80.04 g/mol
Exact Mass80.02
IUPAC Namecarbamic acid fluoride
SMILESNC(=O)O.[F-]
InChIInChI=1S/CH3NO2.FH/c2-1(3)4;/h2H2,(H,3,4);1H/p-1
InChIKeyIZARXXAOJOIUMH-UHFFFAOYSA-M
XLogP-3.37
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50080.04
LogP ≤ 5-3.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze carbamic acid fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

carbamic acid;copper
CID 87387020
carbamic acid;plumbane
CID 173013217
carbamic acid;yttrium
CID 20702274
carbamic acid;cobalt
CID 87314881
carbamic acid;iridium
CID 58983452
carbamic acid;indigane
CID 174683885
carbamic acid;nickel(2+);sulfanide
CID 175324677
Carbamic acid--silanol (1/1)
CID 78063810
carbamic acid;formaldehyde
CID 173133375
magnesium;carbamic acid;carbanide;bromide
CID 118393524
azane;carbamic acid;ethene
CID 173074759
carbamic acid;carbonyl dibromide
CID 161235420

Frequently Asked Questions

What is the IUPAC name of carbamic acid fluoride?
The IUPAC name of carbamic acid fluoride (CID 169488270) is carbamic acid fluoride.
What is the SMILES notation for carbamic acid fluoride?
The canonical SMILES for carbamic acid fluoride is NC(=O)O.[F-].
What is the InChIKey of carbamic acid fluoride?
The InChIKey is IZARXXAOJOIUMH-UHFFFAOYSA-M. The full InChI is InChI=1S/CH3NO2.FH/c2-1(3)4;/h2H2,(H,3,4);1H/p-1.
What are the key properties of carbamic acid fluoride?
carbamic acid fluoride has a molecular weight of 80.04 g/mol, XLogP of -3.37, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid fluoride is sourced from PubChem (CID 169488270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).