About carbamic acid;nickel(2+);sulfanide
carbamic acid;nickel(2+);sulfanide (PubChem CID 175324677) has the molecular formula CH5NNiO2S2
and a molecular weight of 185.88 g/mol. Its IUPAC name is carbamic acid;nickel(2+);sulfanide.
Molecular Properties
| Compound Name | carbamic acid;nickel(2+);sulfanide |
| PubChem CID | 175324677 |
| Molecular Formula | CH5NNiO2S2 |
| Molecular Weight | 185.88 g/mol |
| Exact Mass | 184.91 |
| IUPAC Name | carbamic acid;nickel(2+);sulfanide |
| SMILES | NC(=O)O.[Ni+2].[SH-].[SH-] |
| InChI | InChI=1S/CH3NO2.Ni.2H2S/c2-1(3)4;;;/h2H2,(H,3,4);;2*1H2/q;+2;;/p-2 |
| InChIKey | YHKDVTCGKKGYLZ-UHFFFAOYSA-L |
| XLogP | -0.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.88 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;nickel(2+);sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;nickel(2+);sulfanide?
The IUPAC name of carbamic acid;nickel(2+);sulfanide (CID 175324677) is carbamic acid;nickel(2+);sulfanide.
What is the SMILES notation for carbamic acid;nickel(2+);sulfanide?
The canonical SMILES for carbamic acid;nickel(2+);sulfanide is NC(=O)O.[Ni+2].[SH-].[SH-].
What is the InChIKey of carbamic acid;nickel(2+);sulfanide?
The InChIKey is YHKDVTCGKKGYLZ-UHFFFAOYSA-L. The full InChI is InChI=1S/CH3NO2.Ni.2H2S/c2-1(3)4;;;/h2H2,(H,3,4);;2*1H2/q;+2;;/p-2.
What are the key properties of carbamic acid;nickel(2+);sulfanide?
carbamic acid;nickel(2+);sulfanide has a molecular weight of 185.88 g/mol, XLogP of -0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;nickel(2+);sulfanide is sourced from PubChem (CID 175324677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).