C10H15N3O3 — CID 138570744
(E,2E)-3-[(1-aminoethenylamino)carbamoyl]-2-ethylidenepent-3-enoic acid (PubChem CID 138570744) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is (E,2E)-3-[(1-aminoethenylamino)carbamoyl]-2-ethylidenepent-3-enoic acid.
| Compound Name | (E,2E)-3-[(1-aminoethenylamino)carbamoyl]-2-ethylidenepent-3-enoic acid |
|---|---|
| PubChem CID | 138570744 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (E,2E)-3-[(1-aminoethenylamino)carbamoyl]-2-ethylidenepent-3-enoic acid |
| SMILES | C=C(N)NNC(=O)C(=C/C)/C(=C\C)C(=O)O |
| InChI | InChI=1S/C10H15N3O3/c1-4-7(8(5-2)10(15)16)9(14)13-12-6(3)11/h4-5,12H,3,11H2,1-2H3,(H,13,14)(H,15,16)/b7-4+,8-5+ |
| InChIKey | SBPVCIMTTYXDKZ-NSLJXJERSA-N |
| XLogP | 0.01 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|