C9H12INO2 — CID 88853628
(2E,3Z)-3-amino-2-ethylidene-4-iodo-5-methylhexa-3,5-dienoic acid (PubChem CID 88853628) has the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. Its IUPAC name is (2E,3Z)-3-amino-2-ethylidene-4-iodo-5-methylhexa-3,5-dienoic acid.
| Compound Name | (2E,3Z)-3-amino-2-ethylidene-4-iodo-5-methylhexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 88853628 |
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | (2E,3Z)-3-amino-2-ethylidene-4-iodo-5-methylhexa-3,5-dienoic acid |
| SMILES | C=C(C)/C(I)=C(N)/C(=C\C)C(=O)O |
| InChI | InChI=1S/C9H12INO2/c1-4-6(9(12)13)8(11)7(10)5(2)3/h4H,2,11H2,1,3H3,(H,12,13)/b6-4-,8-7- |
| InChIKey | KPBBOMPMYLGLIW-MOIRPGTBSA-N |
| XLogP | 2.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|