About ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine
ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine (PubChem CID 142040698) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine.
Molecular Properties
| Compound Name | ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine |
| PubChem CID | 142040698 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine |
| SMILES | C/C=C(\C=C(/CC)CNC)CN.CC.CC |
| InChI | InChI=1S/C10H20N2.2C2H6/c1-4-9(7-11)6-10(5-2)8-12-3;2*1-2/h4,6,12H,5,7-8,11H2,1-3H3;2*1-2H3/b9-4+,10-6+;; |
| InChIKey | KIESCDQPCRTWNB-GFGQVBHTSA-N |
| XLogP | 3.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine?
The IUPAC name of ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine (CID 142040698) is ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine.
What is the SMILES notation for ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine?
The canonical SMILES for ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine is C/C=C(\C=C(/CC)CNC)CN.CC.CC.
What is the InChIKey of ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine?
The InChIKey is KIESCDQPCRTWNB-GFGQVBHTSA-N. The full InChI is InChI=1S/C10H20N2.2C2H6/c1-4-9(7-11)6-10(5-2)8-12-3;2*1-2/h4,6,12H,5,7-8,11H2,1-3H3;2*1-2H3/b9-4+,10-6+;;.
What are the key properties of ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine?
ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine has a molecular weight of 228.42 g/mol, XLogP of 3.50, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E,4E)-2-ethyl-4-ethylidene-N-methylpent-2-ene-1,5-diamine is sourced from PubChem (CID 142040698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).