C11H20O — CID 123423064
5-ethyl-3-(methoxymethyl)hepta-2,4-diene (PubChem CID 123423064) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 5-ethyl-3-(methoxymethyl)hepta-2,4-diene.
| Compound Name | 5-ethyl-3-(methoxymethyl)hepta-2,4-diene |
|---|---|
| PubChem CID | 123423064 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 5-ethyl-3-(methoxymethyl)hepta-2,4-diene |
| SMILES | CC=C(C=C(CC)CC)COC |
| InChI | InChI=1S/C11H20O/c1-5-10(6-2)8-11(7-3)9-12-4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | YNRUQDJBQMCIOW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|