About acetaldehyde;1-methoxybutan-2-one
acetaldehyde;1-methoxybutan-2-one (PubChem CID 144521469) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is acetaldehyde;1-methoxybutan-2-one.
Molecular Properties
| Compound Name | acetaldehyde;1-methoxybutan-2-one |
| PubChem CID | 144521469 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | acetaldehyde;1-methoxybutan-2-one |
| SMILES | CC=O.CCC(=O)COC |
| InChI | InChI=1S/C5H10O2.C2H4O/c1-3-5(6)4-7-2;1-2-3/h3-4H2,1-2H3;2H,1H3 |
| InChIKey | GHDLQUNZAVYMMY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1-methoxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1-methoxybutan-2-one?
The IUPAC name of acetaldehyde;1-methoxybutan-2-one (CID 144521469) is acetaldehyde;1-methoxybutan-2-one.
What is the SMILES notation for acetaldehyde;1-methoxybutan-2-one?
The canonical SMILES for acetaldehyde;1-methoxybutan-2-one is CC=O.CCC(=O)COC.
What is the InChIKey of acetaldehyde;1-methoxybutan-2-one?
The InChIKey is GHDLQUNZAVYMMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C2H4O/c1-3-5(6)4-7-2;1-2-3/h3-4H2,1-2H3;2H,1H3.
What are the key properties of acetaldehyde;1-methoxybutan-2-one?
acetaldehyde;1-methoxybutan-2-one has a molecular weight of 146.19 g/mol, XLogP of 0.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1-methoxybutan-2-one is sourced from PubChem (CID 144521469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).