About 1-methoxyheptane-2,5-dione
1-methoxyheptane-2,5-dione (PubChem CID 12648673) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-methoxyheptane-2,5-dione.
Molecular Properties
| Compound Name | 1-methoxyheptane-2,5-dione |
| PubChem CID | 12648673 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-methoxyheptane-2,5-dione |
| SMILES | CCC(=O)CCC(=O)COC |
| InChI | InChI=1S/C8H14O3/c1-3-7(9)4-5-8(10)6-11-2/h3-6H2,1-2H3 |
| InChIKey | OQHYRHQMKYDKQK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxyheptane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyheptane-2,5-dione?
The IUPAC name of 1-methoxyheptane-2,5-dione (CID 12648673) is 1-methoxyheptane-2,5-dione.
What is the SMILES notation for 1-methoxyheptane-2,5-dione?
The canonical SMILES for 1-methoxyheptane-2,5-dione is CCC(=O)CCC(=O)COC.
What is the InChIKey of 1-methoxyheptane-2,5-dione?
The InChIKey is OQHYRHQMKYDKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-7(9)4-5-8(10)6-11-2/h3-6H2,1-2H3.
What are the key properties of 1-methoxyheptane-2,5-dione?
1-methoxyheptane-2,5-dione has a molecular weight of 158.20 g/mol, XLogP of 0.96, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyheptane-2,5-dione is sourced from PubChem (CID 12648673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).