6-methoxy-5-oxohexanoic acid

C7H12O4 — CID 46897878

IUPAC6-methoxy-5-oxohexanoic acid
SMILESCOCC(=O)CCCC(=O)O
InChIInChI=1S/C7H12O4/c1-11-5-6(8)3-2-4-7(9)10/h2-5H2,1H3,(H,9,10)
InChIKeyOCXDOZLXZIHWDG-UHFFFAOYSA-N
MW160.17 g/mol
LogP0.46
Rot. Bonds6

About 6-methoxy-5-oxohexanoic acid

6-methoxy-5-oxohexanoic acid (PubChem CID 46897878) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 6-methoxy-5-oxohexanoic acid.

Molecular Properties

Compound Name6-methoxy-5-oxohexanoic acid
PubChem CID46897878
Molecular FormulaC7H12O4
Molecular Weight160.17 g/mol
Exact Mass160.07
IUPAC Name6-methoxy-5-oxohexanoic acid
SMILESCOCC(=O)CCCC(=O)O
InChIInChI=1S/C7H12O4/c1-11-5-6(8)3-2-4-7(9)10/h2-5H2,1H3,(H,9,10)
InChIKeyOCXDOZLXZIHWDG-UHFFFAOYSA-N
XLogP0.46
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 50.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-methoxy-5-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methoxy-5-oxohexanoic acid?
The IUPAC name of 6-methoxy-5-oxohexanoic acid (CID 46897878) is 6-methoxy-5-oxohexanoic acid.
What is the SMILES notation for 6-methoxy-5-oxohexanoic acid?
The canonical SMILES for 6-methoxy-5-oxohexanoic acid is COCC(=O)CCCC(=O)O.
What is the InChIKey of 6-methoxy-5-oxohexanoic acid?
The InChIKey is OCXDOZLXZIHWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-11-5-6(8)3-2-4-7(9)10/h2-5H2,1H3,(H,9,10).
What are the key properties of 6-methoxy-5-oxohexanoic acid?
6-methoxy-5-oxohexanoic acid has a molecular weight of 160.17 g/mol, XLogP of 0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-5-oxohexanoic acid is sourced from PubChem (CID 46897878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).