C11H20O — CID 143801880
(4E)-5-(methoxymethyl)-2,4-dimethylhepta-2,4-diene (PubChem CID 143801880) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (4E)-5-(methoxymethyl)-2,4-dimethylhepta-2,4-diene.
| Compound Name | (4E)-5-(methoxymethyl)-2,4-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 143801880 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (4E)-5-(methoxymethyl)-2,4-dimethylhepta-2,4-diene |
| SMILES | CC/C(COC)=C(/C)C=C(C)C |
| InChI | InChI=1S/C11H20O/c1-6-11(8-12-5)10(4)7-9(2)3/h7H,6,8H2,1-5H3/b11-10+ |
| InChIKey | GDJMBNCTVITIRJ-ZHACJKMWSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|