C7H14N2O — CID 142870254
(Z,3E)-3-ethylidene-N-methoxybut-1-ene-1,4-diamine (PubChem CID 142870254) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (Z,3E)-3-ethylidene-N-methoxybut-1-ene-1,4-diamine.
| Compound Name | (Z,3E)-3-ethylidene-N-methoxybut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 142870254 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (Z,3E)-3-ethylidene-N-methoxybut-1-ene-1,4-diamine |
| SMILES | C/C=C(\C=C/NOC)CN |
| InChI | InChI=1S/C7H14N2O/c1-3-7(6-8)4-5-9-10-2/h3-5,9H,6,8H2,1-2H3/b5-4-,7-3+ |
| InChIKey | FKZLYMBZTHRTKP-SBYNAHCQSA-N |
| XLogP | 0.56 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|