C8H15NO2 — CID 163804897
(2E,4E)-4-(hydroperoxymethyl)hepta-2,4-dien-2-amine (PubChem CID 163804897) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (2E,4E)-4-(hydroperoxymethyl)hepta-2,4-dien-2-amine.
| Compound Name | (2E,4E)-4-(hydroperoxymethyl)hepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 163804897 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (2E,4E)-4-(hydroperoxymethyl)hepta-2,4-dien-2-amine |
| SMILES | CC/C=C(\C=C(/C)N)COO |
| InChI | InChI=1S/C8H15NO2/c1-3-4-8(6-11-10)5-7(2)9/h4-5,10H,3,6,9H2,1-2H3/b7-5+,8-4+ |
| InChIKey | NIEPFOMCKTZLMF-JBVHCYJISA-N |
| XLogP | 1.67 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|