About 2-methylpent-2-enyl hydrogen carbonate
2-methylpent-2-enyl hydrogen carbonate (PubChem CID 173361904) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-methylpent-2-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-methylpent-2-enyl hydrogen carbonate |
| PubChem CID | 173361904 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2-methylpent-2-enyl hydrogen carbonate |
| SMILES | CCC=C(C)COC(=O)O |
| InChI | InChI=1S/C7H12O3/c1-3-4-6(2)5-10-7(8)9/h4H,3,5H2,1-2H3,(H,8,9) |
| InChIKey | LXXUHNQJKRZFRP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpent-2-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpent-2-enyl hydrogen carbonate?
The IUPAC name of 2-methylpent-2-enyl hydrogen carbonate (CID 173361904) is 2-methylpent-2-enyl hydrogen carbonate.
What is the SMILES notation for 2-methylpent-2-enyl hydrogen carbonate?
The canonical SMILES for 2-methylpent-2-enyl hydrogen carbonate is CCC=C(C)COC(=O)O.
What is the InChIKey of 2-methylpent-2-enyl hydrogen carbonate?
The InChIKey is LXXUHNQJKRZFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-4-6(2)5-10-7(8)9/h4H,3,5H2,1-2H3,(H,8,9).
What are the key properties of 2-methylpent-2-enyl hydrogen carbonate?
2-methylpent-2-enyl hydrogen carbonate has a molecular weight of 144.17 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpent-2-enyl hydrogen carbonate is sourced from PubChem (CID 173361904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).