C22H35N — CID 146174461
(1Z,4E,6E,8Z)-N,4,6,7,10-pentamethyl-3-methylidene-N-pentan-3-ylundeca-1,4,6,8,10-pentaen-1-amine (PubChem CID 146174461) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is (1Z,4E,6E,8Z)-N,4,6,7,10-pentamethyl-3-methylidene-N-pentan-3-ylundeca-1,4,6,8,10-pentaen-1-amine.
| Compound Name | (1Z,4E,6E,8Z)-N,4,6,7,10-pentamethyl-3-methylidene-N-pentan-3-ylundeca-1,4,6,8,10-pentaen-1-amine |
|---|---|
| PubChem CID | 146174461 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | (1Z,4E,6E,8Z)-N,4,6,7,10-pentamethyl-3-methylidene-N-pentan-3-ylundeca-1,4,6,8,10-pentaen-1-amine |
| SMILES | C=C(C)/C=C\C(C)=C(C)\C=C(/C)C(=C)/C=C\N(C)C(CC)CC |
| InChI | InChI=1S/C22H35N/c1-10-22(11-2)23(9)15-14-19(6)21(8)16-20(7)18(5)13-12-17(3)4/h12-16,22H,3,6,10-11H2,1-2,4-5,7-9H3/b13-12-,15-14-,20-18+,21-16+ |
| InChIKey | BZCRZIQMJQXCFN-CVQROULQSA-N |
| XLogP | 6.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|