C20H33N — CID 123748546
N-ethyl-N-methyl-4-(4-methylcyclonona-1,4,6-trien-1-yl)cycloheptan-1-amine (PubChem CID 123748546) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is N-ethyl-N-methyl-4-(4-methylcyclonona-1,4,6-trien-1-yl)cycloheptan-1-amine.
| Compound Name | N-ethyl-N-methyl-4-(4-methylcyclonona-1,4,6-trien-1-yl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 123748546 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-ethyl-N-methyl-4-(4-methylcyclonona-1,4,6-trien-1-yl)cycloheptan-1-amine |
| SMILES | CCN(C)C1CCCC(C2=CCC(C)=CC=CCC2)CC1 |
| InChI | InChI=1S/C20H33N/c1-4-21(3)20-12-8-11-19(15-16-20)18-10-7-5-6-9-17(2)13-14-18/h5-6,9,14,19-20H,4,7-8,10-13,15-16H2,1-3H3 |
| InChIKey | MPELTABZMLWZMS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|