C21H35N — CID 130441282
(5R,7Z)-N,N,10-trimethyl-5-(6-methylcyclohexa-1,3-dien-1-yl)undeca-7,9-dien-3-amine (PubChem CID 130441282) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (5R,7Z)-N,N,10-trimethyl-5-(6-methylcyclohexa-1,3-dien-1-yl)undeca-7,9-dien-3-amine.
| Compound Name | (5R,7Z)-N,N,10-trimethyl-5-(6-methylcyclohexa-1,3-dien-1-yl)undeca-7,9-dien-3-amine |
|---|---|
| PubChem CID | 130441282 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (5R,7Z)-N,N,10-trimethyl-5-(6-methylcyclohexa-1,3-dien-1-yl)undeca-7,9-dien-3-amine |
| SMILES | CCC(C[C@@H](C/C=C\C=C(C)C)C1=CC=CCC1C)N(C)C |
| InChI | InChI=1S/C21H35N/c1-7-20(22(5)6)16-19(14-10-8-12-17(2)3)21-15-11-9-13-18(21)4/h8-12,15,18-20H,7,13-14,16H2,1-6H3/b10-8-/t18?,19-,20?/m1/s1 |
| InChIKey | WHPGIUCCDCWXBI-JVYSGEOZSA-N |
| XLogP | 5.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|