C30H52FN — CID 142548528
(2E,4E)-1-[2,4-dimethyl-5-[(3Z)-5-methylhexa-1,3-dien-2-yl]cyclohexyl]-8-ethyl-N-fluoro-N,3-dimethylundeca-2,4-dien-6-amine (PubChem CID 142548528) has the molecular formula C30H52FN and a molecular weight of 445.75 g/mol. Its IUPAC name is (2E,4E)-1-[2,4-dimethyl-5-[(3Z)-5-methylhexa-1,3-dien-2-yl]cyclohexyl]-8-ethyl-N-fluoro-N,3-dimethylundeca-2,4-dien-6-amine.
| Compound Name | (2E,4E)-1-[2,4-dimethyl-5-[(3Z)-5-methylhexa-1,3-dien-2-yl]cyclohexyl]-8-ethyl-N-fluoro-N,3-dimethylundeca-2,4-dien-6-amine |
|---|---|
| PubChem CID | 142548528 |
| Molecular Formula | C30H52FN |
| Molecular Weight | 445.75 g/mol |
| Exact Mass | 445.41 |
| IUPAC Name | (2E,4E)-1-[2,4-dimethyl-5-[(3Z)-5-methylhexa-1,3-dien-2-yl]cyclohexyl]-8-ethyl-N-fluoro-N,3-dimethylundeca-2,4-dien-6-amine |
| SMILES | C=C(/C=C\C(C)C)C1CC(C/C=C(C)/C=C/C(CC(CC)CCC)N(C)F)C(C)CC1C |
| InChI | InChI=1S/C30H52FN/c1-10-12-27(11-2)20-29(32(9)31)18-15-23(5)14-17-28-21-30(26(8)19-25(28)7)24(6)16-13-22(3)4/h13-16,18,22,25-30H,6,10-12,17,19-21H2,1-5,7-9H3/b16-13-,18-15+,23-14+ |
| InChIKey | RMRDHOOPIROQDR-WSSOWUGWSA-N |
| XLogP | 9.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.75 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|