C26H49N — CID 123522011
6-(3-ethylidenecyclobutyl)-N-(4-methylpentan-2-yl)-N-pentyl-2-prop-1-enylhexan-1-amine (PubChem CID 123522011) has the molecular formula C26H49N and a molecular weight of 375.69 g/mol. Its IUPAC name is 6-(3-ethylidenecyclobutyl)-N-(4-methylpentan-2-yl)-N-pentyl-2-prop-1-enylhexan-1-amine.
| Compound Name | 6-(3-ethylidenecyclobutyl)-N-(4-methylpentan-2-yl)-N-pentyl-2-prop-1-enylhexan-1-amine |
|---|---|
| PubChem CID | 123522011 |
| Molecular Formula | C26H49N |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 375.39 |
| IUPAC Name | 6-(3-ethylidenecyclobutyl)-N-(4-methylpentan-2-yl)-N-pentyl-2-prop-1-enylhexan-1-amine |
| SMILES | CC=CC(CCCCC1CC(=CC)C1)CN(CCCCC)C(C)CC(C)C |
| InChI | InChI=1S/C26H49N/c1-7-10-13-17-27(23(6)18-22(4)5)21-25(14-8-2)15-11-12-16-26-19-24(9-3)20-26/h8-9,14,22-23,25-26H,7,10-13,15-21H2,1-6H3/b14-8?,24-9- |
| InChIKey | YYCVQEIAWKRIFP-OYKHTCASSA-N |
| XLogP | 8.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|