C17H30FN — CID 134365586
(6E,8E)-6-ethenyl-N,5-diethyl-9-fluoro-N-methyldeca-6,8-dien-1-amine (PubChem CID 134365586) has the molecular formula C17H30FN and a molecular weight of 267.43 g/mol. Its IUPAC name is (6E,8E)-6-ethenyl-N,5-diethyl-9-fluoro-N-methyldeca-6,8-dien-1-amine.
| Compound Name | (6E,8E)-6-ethenyl-N,5-diethyl-9-fluoro-N-methyldeca-6,8-dien-1-amine |
|---|---|
| PubChem CID | 134365586 |
| Molecular Formula | C17H30FN |
| Molecular Weight | 267.43 g/mol |
| Exact Mass | 267.24 |
| IUPAC Name | (6E,8E)-6-ethenyl-N,5-diethyl-9-fluoro-N-methyldeca-6,8-dien-1-amine |
| SMILES | C=C/C(=C\C=C(/C)F)C(CC)CCCCN(C)CC |
| InChI | InChI=1S/C17H30FN/c1-6-16(11-9-10-14-19(5)8-3)17(7-2)13-12-15(4)18/h7,12-13,16H,2,6,8-11,14H2,1,3-5H3/b15-12+,17-13+ |
| InChIKey | UHKTVUZBLGAZKT-KDOCSACZSA-N |
| XLogP | 5.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|