C15H22FN — CID 129131717
4-[1-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)ethenyl]-1-methylpiperidine (PubChem CID 129131717) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-[1-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)ethenyl]-1-methylpiperidine.
| Compound Name | 4-[1-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)ethenyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 129131717 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 4-[1-(4-fluoro-1-methylcyclohexa-2,4-dien-1-yl)ethenyl]-1-methylpiperidine |
| SMILES | C=C(C1CCN(C)CC1)C1(C)C=CC(F)=CC1 |
| InChI | InChI=1S/C15H22FN/c1-12(13-6-10-17(3)11-7-13)15(2)8-4-14(16)5-9-15/h4-5,8,13H,1,6-7,9-11H2,2-3H3 |
| InChIKey | AUOSPFHZOAMSTL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|