C19H32FN — CID 130216894
4-fluoro-1-[(Z,2E)-3-methyl-2-propylidenehex-3-enyl]-4-prop-2-enylazepane (PubChem CID 130216894) has the molecular formula C19H32FN and a molecular weight of 293.47 g/mol. Its IUPAC name is 4-fluoro-1-[(Z,2E)-3-methyl-2-propylidenehex-3-enyl]-4-prop-2-enylazepane.
| Compound Name | 4-fluoro-1-[(Z,2E)-3-methyl-2-propylidenehex-3-enyl]-4-prop-2-enylazepane |
|---|---|
| PubChem CID | 130216894 |
| Molecular Formula | C19H32FN |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 4-fluoro-1-[(Z,2E)-3-methyl-2-propylidenehex-3-enyl]-4-prop-2-enylazepane |
| SMILES | C=CCC1(F)CCCN(CC(=C/CC)/C(C)=C\CC)CC1 |
| InChI | InChI=1S/C19H32FN/c1-5-9-17(4)18(10-6-2)16-21-14-8-12-19(20,11-7-3)13-15-21/h7,9-10H,3,5-6,8,11-16H2,1-2,4H3/b17-9-,18-10- |
| InChIKey | HYQUFJTVJTZBNV-XFQWXJFMSA-N |
| XLogP | 5.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|