C14H20FN — CID 144635900
4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1-methylazepane (PubChem CID 144635900) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1-methylazepane.
| Compound Name | 4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1-methylazepane |
|---|---|
| PubChem CID | 144635900 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1-methylazepane |
| SMILES | CN1CCCC(C2=CCC=C(F)C=C2)CC1 |
| InChI | InChI=1S/C14H20FN/c1-16-10-3-5-13(9-11-16)12-4-2-6-14(15)8-7-12/h4,6-8,13H,2-3,5,9-11H2,1H3 |
| InChIKey | LAPSSPBBWGEODT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |