C13H18FN — CID 123319465
3-(5-fluorocyclohepta-1,4,6-trien-1-yl)azepane (PubChem CID 123319465) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)azepane.
| Compound Name | 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)azepane |
|---|---|
| PubChem CID | 123319465 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)azepane |
| SMILES | FC1=CCC=C(C2CCCCNC2)C=C1 |
| InChI | InChI=1S/C13H18FN/c14-13-6-3-5-11(7-8-13)12-4-1-2-9-15-10-12/h5-8,12,15H,1-4,9-10H2 |
| InChIKey | ZCEKCLOUIHGPJY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |