C12H20FN — CID 142170706
(5Z)-N-ethyl-7-fluoro-3-methyl-4-methylideneocta-5,7-dien-1-amine (PubChem CID 142170706) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is (5Z)-N-ethyl-7-fluoro-3-methyl-4-methylideneocta-5,7-dien-1-amine.
| Compound Name | (5Z)-N-ethyl-7-fluoro-3-methyl-4-methylideneocta-5,7-dien-1-amine |
|---|---|
| PubChem CID | 142170706 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (5Z)-N-ethyl-7-fluoro-3-methyl-4-methylideneocta-5,7-dien-1-amine |
| SMILES | C=C(F)/C=C\C(=C)C(C)CCNCC |
| InChI | InChI=1S/C12H20FN/c1-5-14-9-8-11(3)10(2)6-7-12(4)13/h6-7,11,14H,2,4-5,8-9H2,1,3H3/b7-6- |
| InChIKey | UZWPBOUBEYVCFU-SREVYHEPSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|