C13H23FN2 — CID 91377758
4-[1-(2-fluoroethyl)piperidin-4-yl]hexa-2,4-dien-1-amine (PubChem CID 91377758) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is 4-[1-(2-fluoroethyl)piperidin-4-yl]hexa-2,4-dien-1-amine.
| Compound Name | 4-[1-(2-fluoroethyl)piperidin-4-yl]hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 91377758 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 4-[1-(2-fluoroethyl)piperidin-4-yl]hexa-2,4-dien-1-amine |
| SMILES | CC=C(C=CCN)C1CCN(CCF)CC1 |
| InChI | InChI=1S/C13H23FN2/c1-2-12(4-3-8-15)13-5-9-16(10-6-13)11-7-14/h2-4,13H,5-11,15H2,1H3 |
| InChIKey | MIQMWGJUYKBNDJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|