C15H24FN — CID 134365657
(4R)-4-[(1E,3E,6Z)-4-fluorocycloocta-1,3,6-trien-1-yl]-N-methylhexan-1-amine (PubChem CID 134365657) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is (4R)-4-[(1E,3E,6Z)-4-fluorocycloocta-1,3,6-trien-1-yl]-N-methylhexan-1-amine.
| Compound Name | (4R)-4-[(1E,3E,6Z)-4-fluorocycloocta-1,3,6-trien-1-yl]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 134365657 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | (4R)-4-[(1E,3E,6Z)-4-fluorocycloocta-1,3,6-trien-1-yl]-N-methylhexan-1-amine |
| SMILES | CC[C@H](CCCNC)/C1=C/C=C(/F)C/C=C\C1 |
| InChI | InChI=1S/C15H24FN/c1-3-13(8-6-12-17-2)14-7-4-5-9-15(16)11-10-14/h4-5,10-11,13,17H,3,6-9,12H2,1-2H3/b5-4-,14-10+,15-11+/t13-/m1/s1 |
| InChIKey | QPBBLAAJFWUIKN-XOTGNOQQSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|