C11H16FN — CID 89358844
4-(4-fluorocyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 89358844) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 4-(4-fluorocyclohexa-1,3-dien-1-yl)piperidine.
| Compound Name | 4-(4-fluorocyclohexa-1,3-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 89358844 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 4-(4-fluorocyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | FC1=CC=C(C2CCNCC2)CC1 |
| InChI | InChI=1S/C11H16FN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1,3,10,13H,2,4-8H2 |
| InChIKey | QLBWQEOQAVQOAQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |