C11H10ClF4N — CID 117116603
4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperidine (PubChem CID 117116603) has the molecular formula C11H10ClF4N and a molecular weight of 267.65 g/mol. Its IUPAC name is 4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperidine.
| Compound Name | 4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperidine |
|---|---|
| PubChem CID | 117116603 |
| Molecular Formula | C11H10ClF4N |
| Molecular Weight | 267.65 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperidine |
| SMILES | Fc1c(F)c(C2CCNCC2)c(F)c(F)c1Cl |
| InChI | InChI=1S/C11H10ClF4N/c12-7-10(15)8(13)6(9(14)11(7)16)5-1-3-17-4-2-5/h5,17H,1-4H2 |
| InChIKey | SOUFRJFKPMNOFM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|