C11H13ClFNO2 — CID 117366624
5-chloro-4-fluoro-3-piperidin-4-ylbenzene-1,2-diol (PubChem CID 117366624) has the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. Its IUPAC name is 5-chloro-4-fluoro-3-piperidin-4-ylbenzene-1,2-diol.
| Compound Name | 5-chloro-4-fluoro-3-piperidin-4-ylbenzene-1,2-diol |
|---|---|
| PubChem CID | 117366624 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-chloro-4-fluoro-3-piperidin-4-ylbenzene-1,2-diol |
| SMILES | Oc1cc(Cl)c(F)c(C2CCNCC2)c1O |
| InChI | InChI=1S/C11H13ClFNO2/c12-7-5-8(15)11(16)9(10(7)13)6-1-3-14-4-2-6/h5-6,14-16H,1-4H2 |
| InChIKey | IDVQWNISGDZDJN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|