C11H12Cl2FN — CID 117372762
4-(3,5-dichloro-4-fluorophenyl)piperidine (PubChem CID 117372762) has the molecular formula C11H12Cl2FN and a molecular weight of 248.13 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-fluorophenyl)piperidine.
| Compound Name | 4-(3,5-dichloro-4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 117372762 |
| Molecular Formula | C11H12Cl2FN |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 4-(3,5-dichloro-4-fluorophenyl)piperidine |
| SMILES | Fc1c(Cl)cc(C2CCNCC2)cc1Cl |
| InChI | InChI=1S/C11H12Cl2FN/c12-9-5-8(6-10(13)11(9)14)7-1-3-15-4-2-7/h5-7,15H,1-4H2 |
| InChIKey | RAEOKBYIUNEZKX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|