C13H18ClNO — CID 84800158
4-chloro-3,5-dimethyl-2-piperidin-4-ylphenol (PubChem CID 84800158) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 4-chloro-3,5-dimethyl-2-piperidin-4-ylphenol.
| Compound Name | 4-chloro-3,5-dimethyl-2-piperidin-4-ylphenol |
|---|---|
| PubChem CID | 84800158 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-chloro-3,5-dimethyl-2-piperidin-4-ylphenol |
| SMILES | Cc1cc(O)c(C2CCNCC2)c(C)c1Cl |
| InChI | InChI=1S/C13H18ClNO/c1-8-7-11(16)12(9(2)13(8)14)10-3-5-15-6-4-10/h7,10,15-16H,3-6H2,1-2H3 |
| InChIKey | DXEZVXAZQYPOGM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |