C10H8BrClF3N — CID 117116714
3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)pyrrolidine (PubChem CID 117116714) has the molecular formula C10H8BrClF3N and a molecular weight of 314.53 g/mol. Its IUPAC name is 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)pyrrolidine.
| Compound Name | 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 117116714 |
| Molecular Formula | C10H8BrClF3N |
| Molecular Weight | 314.53 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)pyrrolidine |
| SMILES | Fc1c(F)c(C2CCNC2)c(Br)c(F)c1Cl |
| InChI | InChI=1S/C10H8BrClF3N/c11-6-5(4-1-2-16-3-4)8(13)10(15)7(12)9(6)14/h4,16H,1-3H2 |
| InChIKey | ISOCJHAVXZLHMB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|