C12H20FN — CID 142871635
4-[(4E)-5-fluorohepta-4,6-dienyl]piperidine (PubChem CID 142871635) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is 4-[(4E)-5-fluorohepta-4,6-dienyl]piperidine.
| Compound Name | 4-[(4E)-5-fluorohepta-4,6-dienyl]piperidine |
|---|---|
| PubChem CID | 142871635 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 4-[(4E)-5-fluorohepta-4,6-dienyl]piperidine |
| SMILES | C=C/C(F)=C\CCCC1CCNCC1 |
| InChI | InChI=1S/C12H20FN/c1-2-12(13)6-4-3-5-11-7-9-14-10-8-11/h2,6,11,14H,1,3-5,7-10H2/b12-6+ |
| InChIKey | LZYLZKCSRMTCIU-WUXMJOGZSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|