C12H18FN — CID 143792374
4-(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 143792374) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 4-(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperidine.
| Compound Name | 4-(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 143792374 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | CC1CC=CC(F)=C1C1CCNCC1 |
| InChI | InChI=1S/C12H18FN/c1-9-3-2-4-11(13)12(9)10-5-7-14-8-6-10/h2,4,9-10,14H,3,5-8H2,1H3 |
| InChIKey | NBDXDZYEOSILBH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |