C13H15N — CID 53797068
1,2,3,4,10a,10b-Hexahydrobenzo[f]isoquinoline (PubChem CID 53797068) has the molecular formula C13H15N and a molecular weight of 185.26 g/mol. Its IUPAC name is 1,2,3,4,10a,10b-hexahydrobenzo[f]isoquinoline.
| Compound Name | 1,2,3,4,10a,10b-Hexahydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 53797068 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.26 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1,2,3,4,10a,10b-hexahydrobenzo[f]isoquinoline |
| SMILES | C1CNCC2=CC=C3C=CC=CC3C21 |
| InChI | InChI=1S/C13H15N/c1-2-4-12-10(3-1)5-6-11-9-14-8-7-13(11)12/h1-6,12-14H,7-9H2 |
| InChIKey | FFTFIZJGQYESLU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 357 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |