About Octahydrobenzoquinoline
Octahydrobenzoquinoline (PubChem CID 67195051) has the molecular formula C13H17N
and a molecular weight of 187.28 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,6a-octahydrobenzo[h]quinoline.
Molecular Properties
| Compound Name | Octahydrobenzoquinoline |
| PubChem CID | 67195051 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1,2,3,4,4a,5,6,6a-octahydrobenzo[h]quinoline |
| SMILES | C1CC2CCC3C=CC=CC3=C2NC1 |
| InChI | InChI=1S/C13H17N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-2,4,6,10-11,14H,3,5,7-9H2 |
| InChIKey | OHVAIUSHSXPOGH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 322 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Octahydrobenzoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Octahydrobenzoquinoline?
The IUPAC name of Octahydrobenzoquinoline (CID 67195051) is 1,2,3,4,4a,5,6,6a-octahydrobenzo[h]quinoline.
What is the SMILES notation for Octahydrobenzoquinoline?
The canonical SMILES for Octahydrobenzoquinoline is C1CC2CCC3C=CC=CC3=C2NC1.
What is the InChIKey of Octahydrobenzoquinoline?
The InChIKey is OHVAIUSHSXPOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-2,4,6,10-11,14H,3,5,7-9H2.
What are the key properties of Octahydrobenzoquinoline?
Octahydrobenzoquinoline has a molecular weight of 187.28 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Octahydrobenzoquinoline is sourced from PubChem (CID 67195051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).