About 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline
1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline (PubChem CID 66925930) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline.
Analyze 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline?
The IUPAC name of 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline (CID 66925930) is 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline.
What is the SMILES notation for 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline?
The canonical SMILES for 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline is C=C1NCCC2CC=CC=C12.
What is the InChIKey of 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline?
The InChIKey is DOPVCGUFOKCNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-8-10-5-3-2-4-9(10)6-7-11-8/h2-3,5,9,11H,1,4,6-7H2.
What are the key properties of 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline?
1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline has a molecular weight of 147.22 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylidene-3,4,4a,5-tetrahydro-2H-isoquinoline is sourced from PubChem (CID 66925930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).