C13H20FN — CID 134365826
4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azepane (PubChem CID 134365826) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azepane.
| Compound Name | 4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azepane |
|---|---|
| PubChem CID | 134365826 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azepane |
| SMILES | C/C=C\C(F)=C/C=C/C1CCCNCC1 |
| InChI | InChI=1S/C13H20FN/c1-2-5-13(14)8-3-6-12-7-4-10-15-11-9-12/h2-3,5-6,8,12,15H,4,7,9-11H2,1H3/b5-2-,6-3+,13-8+ |
| InChIKey | PSJGABSSVJMQTE-WNABQXTHSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|