About 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane
4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane (PubChem CID 134365685) has the molecular formula C15H26FN
and a molecular weight of 239.38 g/mol. Its IUPAC name is 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane.
Molecular Properties
| Compound Name | 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane |
| PubChem CID | 134365685 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane |
| SMILES | CC/C=C(F)\C=C/C(C)C1CCCN(C)CC1 |
| InChI | InChI=1S/C15H26FN/c1-4-6-15(16)9-8-13(2)14-7-5-11-17(3)12-10-14/h6,8-9,13-14H,4-5,7,10-12H2,1-3H3/b9-8-,15-6+ |
| InChIKey | UEJNCBPRSOSOGA-GMLODJKISA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane?
The IUPAC name of 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane (CID 134365685) is 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane.
What is the SMILES notation for 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane?
The canonical SMILES for 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane is CC/C=C(F)\C=C/C(C)C1CCCN(C)CC1.
What is the InChIKey of 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane?
The InChIKey is UEJNCBPRSOSOGA-GMLODJKISA-N. The full InChI is InChI=1S/C15H26FN/c1-4-6-15(16)9-8-13(2)14-7-5-11-17(3)12-10-14/h6,8-9,13-14H,4-5,7,10-12H2,1-3H3/b9-8-,15-6+.
What are the key properties of 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane?
4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane has a molecular weight of 239.38 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane is sourced from PubChem (CID 134365685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).