C15H26FN — CID 134365685
4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane (PubChem CID 134365685) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane.
| Compound Name | 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane |
|---|---|
| PubChem CID | 134365685 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 4-[(3Z,5E)-5-fluoroocta-3,5-dien-2-yl]-1-methylazepane |
| SMILES | CC/C=C(F)\C=C/C(C)C1CCCN(C)CC1 |
| InChI | InChI=1S/C15H26FN/c1-4-6-15(16)9-8-13(2)14-7-5-11-17(3)12-10-14/h6,8-9,13-14H,4-5,7,10-12H2,1-3H3/b9-8-,15-6+ |
| InChIKey | UEJNCBPRSOSOGA-GMLODJKISA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|