C16H22FN — CID 134365707
4-[(6Z)-8-fluoronona-1,3,4,6,8-pentaen-5-yl]-1-methylazepane (PubChem CID 134365707) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is 4-[(6Z)-8-fluoronona-1,3,4,6,8-pentaen-5-yl]-1-methylazepane.
| Compound Name | 4-[(6Z)-8-fluoronona-1,3,4,6,8-pentaen-5-yl]-1-methylazepane |
|---|---|
| PubChem CID | 134365707 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 4-[(6Z)-8-fluoronona-1,3,4,6,8-pentaen-5-yl]-1-methylazepane |
| SMILES | C=CC=C=C(/C=C\C(=C)F)C1CCCN(C)CC1 |
| InChI | InChI=1S/C16H22FN/c1-4-5-7-15(10-9-14(2)17)16-8-6-12-18(3)13-11-16/h4-5,9-10,16H,1-2,6,8,11-13H2,3H3/b10-9- |
| InChIKey | MWJBQBKGYGGHBX-KTKRTIGZSA-N |
| XLogP | 4.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|