C13H20FN — CID 134292370
(3R)-3-[(2E,4Z)-3-fluoro-4-methylhepta-2,4,6-trienyl]piperidine (PubChem CID 134292370) has the molecular formula C13H20FN and a molecular weight of 209.30 g/mol. Its IUPAC name is (3R)-3-[(2E,4Z)-3-fluoro-4-methylhepta-2,4,6-trienyl]piperidine.
| Compound Name | (3R)-3-[(2E,4Z)-3-fluoro-4-methylhepta-2,4,6-trienyl]piperidine |
|---|---|
| PubChem CID | 134292370 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (3R)-3-[(2E,4Z)-3-fluoro-4-methylhepta-2,4,6-trienyl]piperidine |
| SMILES | C/C(=C/C=C)/C(=C\C[C@H]1CCCNC1)/F |
| InChI | InChI=1S/C13H20FN/c1-3-5-11(2)13(14)8-7-12-6-4-9-15-10-12/h3,5,8,12,15H,1,4,6-7,9-10H2,2H3/b11-5-,13-8+/t12-/m1/s1 |
| InChIKey | XKEUKGFYHSPSIL-LNMYIWMBSA-N |
| XLogP | 3.40 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 266 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|