C10H14FN — CID 141457985
8-fluoro-2,3,4,5,5a,6-hexahydro-1H-1-benzazepine (PubChem CID 141457985) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 8-fluoro-2,3,4,5,5a,6-hexahydro-1H-1-benzazepine.
| Compound Name | 8-fluoro-2,3,4,5,5a,6-hexahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 141457985 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 8-fluoro-2,3,4,5,5a,6-hexahydro-1H-1-benzazepine |
| SMILES | FC1=CCC2CCCCNC2=C1 |
| InChI | InChI=1S/C10H14FN/c11-9-5-4-8-3-1-2-6-12-10(8)7-9/h5,7-8,12H,1-4,6H2 |
| InChIKey | JCXCQAMLKJPBHJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |