About ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene
ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene (PubChem CID 143232061) has the molecular formula C16H28F3N
and a molecular weight of 291.40 g/mol. Its IUPAC name is ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene.
Molecular Properties
| Compound Name | ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene |
| PubChem CID | 143232061 |
| Molecular Formula | C16H28F3N |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene |
| SMILES | CC.CCN1C/C=C(C(F)(F)F)\C=C/C(C)CCCC1 |
| InChI | InChI=1S/C14H22F3N.C2H6/c1-3-18-10-5-4-6-12(2)7-8-13(9-11-18)14(15,16)17;1-2/h7-9,12H,3-6,10-11H2,1-2H3;1-2H3/b8-7-,13-9+; |
| InChIKey | MDTMQMHNGIOLBZ-CZXYQAPFSA-N |
| XLogP | 5.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene?
The IUPAC name of ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene (CID 143232061) is ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene.
What is the SMILES notation for ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene?
The canonical SMILES for ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene is CC.CCN1C/C=C(C(F)(F)F)\C=C/C(C)CCCC1.
What is the InChIKey of ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene?
The InChIKey is MDTMQMHNGIOLBZ-CZXYQAPFSA-N. The full InChI is InChI=1S/C14H22F3N.C2H6/c1-3-18-10-5-4-6-12(2)7-8-13(9-11-18)14(15,16)17;1-2/h7-9,12H,3-6,10-11H2,1-2H3;1-2H3/b8-7-,13-9+;.
What are the key properties of ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene?
ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene has a molecular weight of 291.40 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E,5Z)-1-ethyl-7-methyl-4-(trifluoromethyl)-1-azacycloundeca-3,5-diene is sourced from PubChem (CID 143232061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).