C21H42N2 — CID 143207315
ethane;(2Z,4E)-5-(piperidin-1-ylmethyl)trideca-2,4-dien-6-amine (PubChem CID 143207315) has the molecular formula C21H42N2 and a molecular weight of 322.58 g/mol. Its IUPAC name is ethane;(2Z,4E)-5-(piperidin-1-ylmethyl)trideca-2,4-dien-6-amine.
| Compound Name | ethane;(2Z,4E)-5-(piperidin-1-ylmethyl)trideca-2,4-dien-6-amine |
|---|---|
| PubChem CID | 143207315 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | ethane;(2Z,4E)-5-(piperidin-1-ylmethyl)trideca-2,4-dien-6-amine |
| SMILES | C/C=C\C=C(/CN1CCCCC1)C(N)CCCCCCC.CC |
| InChI | InChI=1S/C19H36N2.C2H6/c1-3-5-7-8-10-14-19(20)18(13-6-4-2)17-21-15-11-9-12-16-21;1-2/h4,6,13,19H,3,5,7-12,14-17,20H2,1-2H3;1-2H3/b6-4-,18-13+; |
| InChIKey | FYVDQIRSWILOFG-ZXJQMLAYSA-N |
| XLogP | 5.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|