C13H22N2 — CID 167290609
1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazine (PubChem CID 167290609) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazine.
| Compound Name | 1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazine |
|---|---|
| PubChem CID | 167290609 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazine |
| SMILES | C=C/C(=C\C=C/C)N1CCN(CC)CC1 |
| InChI | InChI=1S/C13H22N2/c1-4-7-8-13(5-2)15-11-9-14(6-3)10-12-15/h4-5,7-8H,2,6,9-12H2,1,3H3/b7-4-,13-8+ |
| InChIKey | OQSNSTRQYWLMTE-PZADHXCOSA-N |
| XLogP | 2.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|