C23H30N5OP — CID 130370591
N-(4-dimethylphosphorylphenyl)-6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]pyrimidin-4-amine (PubChem CID 130370591) has the molecular formula C23H30N5OP and a molecular weight of 423.50 g/mol. Its IUPAC name is N-(4-dimethylphosphorylphenyl)-6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-(4-dimethylphosphorylphenyl)-6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130370591 |
| Molecular Formula | C23H30N5OP |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-(4-dimethylphosphorylphenyl)-6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]pyrimidin-4-amine |
| SMILES | C=C/C(=C\C=C/C)N1CCN(c2cc(Nc3ccc(P(C)(C)=O)cc3)ncn2)CC1 |
| InChI | InChI=1S/C23H30N5OP/c1-5-7-8-20(6-2)27-13-15-28(16-14-27)23-17-22(24-18-25-23)26-19-9-11-21(12-10-19)30(3,4)29/h5-12,17-18H,2,13-16H2,1,3-4H3,(H,24,25,26)/b7-5-,20-8+ |
| InChIKey | TVTPYPDNIRMPML-GPOYWNOFSA-N |
| XLogP | 4.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|