C9H14F2N2O — CID 146389433
4,4-difluoro-1-(4-methylpiperazin-1-yl)but-3-en-2-one (PubChem CID 146389433) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 4,4-difluoro-1-(4-methylpiperazin-1-yl)but-3-en-2-one.
| Compound Name | 4,4-difluoro-1-(4-methylpiperazin-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 146389433 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 4,4-difluoro-1-(4-methylpiperazin-1-yl)but-3-en-2-one |
| SMILES | CN1CCN(CC(=O)C=C(F)F)CC1 |
| InChI | InChI=1S/C9H14F2N2O/c1-12-2-4-13(5-3-12)7-8(14)6-9(10)11/h6H,2-5,7H2,1H3 |
| InChIKey | RRUOWWLFINBGFJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|