C11H16O2 — CID 121220543
methyl (2E)-2-methyl-6-methylideneocta-2,7-dienoate (PubChem CID 121220543) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is methyl (2E)-2-methyl-6-methylideneocta-2,7-dienoate.
| Compound Name | methyl (2E)-2-methyl-6-methylideneocta-2,7-dienoate |
|---|---|
| PubChem CID | 121220543 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | methyl (2E)-2-methyl-6-methylideneocta-2,7-dienoate |
| SMILES | C=CC(=C)CC/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C11H16O2/c1-5-9(2)7-6-8-10(3)11(12)13-4/h5,8H,1-2,6-7H2,3-4H3/b10-8+ |
| InChIKey | OHJYCFSTRMINHO-CSKARUKUSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|