C20H32O4 — CID 166542020
methyl (4E,8E)-2-acetyl-5-(hydroxymethyl)-9,13-dimethyltetradeca-4,8,12-trienoate (PubChem CID 166542020) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is methyl (4E,8E)-2-acetyl-5-(hydroxymethyl)-9,13-dimethyltetradeca-4,8,12-trienoate.
| Compound Name | methyl (4E,8E)-2-acetyl-5-(hydroxymethyl)-9,13-dimethyltetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 166542020 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | methyl (4E,8E)-2-acetyl-5-(hydroxymethyl)-9,13-dimethyltetradeca-4,8,12-trienoate |
| SMILES | COC(=O)C(C/C=C(/CO)CC/C=C(\C)CCC=C(C)C)C(C)=O |
| InChI | InChI=1S/C20H32O4/c1-15(2)8-6-9-16(3)10-7-11-18(14-21)12-13-19(17(4)22)20(23)24-5/h8,10,12,19,21H,6-7,9,11,13-14H2,1-5H3/b16-10+,18-12+ |
| InChIKey | JIXCHVUWSFLRPW-VKXALQBDSA-N |
| XLogP | 4.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|